C27H30N2O4 — CID 11719273
tert-butyl 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]indole-1-carboxylate (PubChem CID 11719273) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is tert-butyl 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 11719273 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | tert-butyl 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]indol-3-yl]methyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(Cc2cn(C(=O)OC(C)(C)C)c3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C27H30N2O4/c1-26(2,3)32-24(30)28-16-18(20-11-7-9-13-22(20)28)15-19-17-29(25(31)33-27(4,5)6)23-14-10-8-12-21(19)23/h7-14,16-17H,15H2,1-6H3 |
| InChIKey | JTMVOJSKGPEWPL-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |