C17H21NO3 — CID 172551966
tert-butyl 3-(4-oxobutyl)indole-1-carboxylate (PubChem CID 172551966) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl 3-(4-oxobutyl)indole-1-carboxylate.
| Compound Name | tert-butyl 3-(4-oxobutyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 172551966 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | tert-butyl 3-(4-oxobutyl)indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CCCC=O)c2ccccc21 |
| InChI | InChI=1S/C17H21NO3/c1-17(2,3)21-16(20)18-12-13(8-6-7-11-19)14-9-4-5-10-15(14)18/h4-5,9-12H,6-8H2,1-3H3 |
| InChIKey | ROFKGIQDVOGKCU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|