C17H22N2O3 — CID 134493069
tert-butyl 3-[(2S)-3-amino-2-methyl-3-oxopropyl]indole-1-carboxylate (PubChem CID 134493069) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is tert-butyl 3-[(2S)-3-amino-2-methyl-3-oxopropyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S)-3-amino-2-methyl-3-oxopropyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 134493069 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | tert-butyl 3-[(2S)-3-amino-2-methyl-3-oxopropyl]indole-1-carboxylate |
| SMILES | C[C@@H](Cc1cn(C(=O)OC(C)(C)C)c2ccccc12)C(N)=O |
| InChI | InChI=1S/C17H22N2O3/c1-11(15(18)20)9-12-10-19(16(21)22-17(2,3)4)14-8-6-5-7-13(12)14/h5-8,10-11H,9H2,1-4H3,(H2,18,20)/t11-/m0/s1 |
| InChIKey | OTKRJSUIFRVQBZ-NSHDSACASA-N |
| XLogP | 3.09 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |