C17H23N3O3 — CID 56984917
tert-butyl N-[(2R)-1-(1-carbamoylindol-3-yl)propan-2-yl]carbamate (PubChem CID 56984917) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-(1-carbamoylindol-3-yl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-(1-carbamoylindol-3-yl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 56984917 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | tert-butyl N-[(2R)-1-(1-carbamoylindol-3-yl)propan-2-yl]carbamate |
| SMILES | C[C@H](Cc1cn(C(N)=O)c2ccccc12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23N3O3/c1-11(19-16(22)23-17(2,3)4)9-12-10-20(15(18)21)14-8-6-5-7-13(12)14/h5-8,10-11H,9H2,1-4H3,(H2,18,21)(H,19,22)/t11-/m1/s1 |
| InChIKey | USTNMRCUEORGQL-LLVKDONJSA-N |
| XLogP | 3.02 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |