C17H19F3N2O4 — CID 100932933
tert-butyl 3-[2-[(2,2,2-trifluoroacetyl)oxyamino]ethyl]indole-1-carboxylate (PubChem CID 100932933) has the molecular formula C17H19F3N2O4 and a molecular weight of 372.34 g/mol. Its IUPAC name is tert-butyl 3-[2-[(2,2,2-trifluoroacetyl)oxyamino]ethyl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[2-[(2,2,2-trifluoroacetyl)oxyamino]ethyl]indole-1-carboxylate |
|---|---|
| PubChem CID | 100932933 |
| Molecular Formula | C17H19F3N2O4 |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | tert-butyl 3-[2-[(2,2,2-trifluoroacetyl)oxyamino]ethyl]indole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cc(CCNOC(=O)C(F)(F)F)c2ccccc21 |
| InChI | InChI=1S/C17H19F3N2O4/c1-16(2,3)25-15(24)22-10-11(12-6-4-5-7-13(12)22)8-9-21-26-14(23)17(18,19)20/h4-7,10,21H,8-9H2,1-3H3 |
| InChIKey | QUJKJEJKPOUSKR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|