C22H23ClN2O3 — CID 130436394
tert-butyl N-[2-[1-(2-chlorobenzoyl)indol-3-yl]ethyl]carbamate (PubChem CID 130436394) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2-chlorobenzoyl)indol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2-chlorobenzoyl)indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 130436394 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | tert-butyl N-[2-[1-(2-chlorobenzoyl)indol-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cn(C(=O)c2ccccc2Cl)c2ccccc12 |
| InChI | InChI=1S/C22H23ClN2O3/c1-22(2,3)28-21(27)24-13-12-15-14-25(19-11-7-5-8-16(15)19)20(26)17-9-4-6-10-18(17)23/h4-11,14H,12-13H2,1-3H3,(H,24,27) |
| InChIKey | JCGLPKFDZHIDAN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |