C23H25N3O3 — CID 145370928
tert-butyl N-[2-[1-[(3Z)-6-cyano-2-methylidenehexa-3,5-dienoyl]indol-3-yl]ethyl]carbamate (PubChem CID 145370928) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is tert-butyl N-[2-[1-[(3Z)-6-cyano-2-methylidenehexa-3,5-dienoyl]indol-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-[(3Z)-6-cyano-2-methylidenehexa-3,5-dienoyl]indol-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 145370928 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | tert-butyl N-[2-[1-[(3Z)-6-cyano-2-methylidenehexa-3,5-dienoyl]indol-3-yl]ethyl]carbamate |
| SMILES | C=C(/C=C\C=CC#N)C(=O)n1cc(CCNC(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C23H25N3O3/c1-17(10-6-5-9-14-24)21(27)26-16-18(19-11-7-8-12-20(19)26)13-15-25-22(28)29-23(2,3)4/h5-12,16H,1,13,15H2,2-4H3,(H,25,28)/b9-5?,10-6- |
| InChIKey | WEXDTRHRFJIJLW-KRIGNUICSA-N |
| XLogP | 4.54 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|