C19H23NO2 — CID 142472908
tert-butyl N-[2-(1-ethenylnaphthalen-2-yl)ethyl]carbamate (PubChem CID 142472908) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is tert-butyl N-[2-(1-ethenylnaphthalen-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(1-ethenylnaphthalen-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 142472908 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | tert-butyl N-[2-(1-ethenylnaphthalen-2-yl)ethyl]carbamate |
| SMILES | C=Cc1c(CCNC(=O)OC(C)(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C19H23NO2/c1-5-16-15(11-10-14-8-6-7-9-17(14)16)12-13-20-18(21)22-19(2,3)4/h5-11H,1,12-13H2,2-4H3,(H,20,21) |
| InChIKey | WLMWTJYWVAYGAX-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |