C16H24ClN3O3 — CID 108864598
tert-butyl N-[2-[2-(2-chlorophenyl)ethylcarbamoylamino]ethyl]carbamate (PubChem CID 108864598) has the molecular formula C16H24ClN3O3 and a molecular weight of 341.84 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-chlorophenyl)ethylcarbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-chlorophenyl)ethylcarbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 108864598 |
| Molecular Formula | C16H24ClN3O3 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | tert-butyl N-[2-[2-(2-chlorophenyl)ethylcarbamoylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNC(=O)NCCc1ccccc1Cl |
| InChI | InChI=1S/C16H24ClN3O3/c1-16(2,3)23-15(22)20-11-10-19-14(21)18-9-8-12-6-4-5-7-13(12)17/h4-7H,8-11H2,1-3H3,(H,20,22)(H2,18,19,21) |
| InChIKey | DMFMOLUIWRLHJV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|