C16H23ClN2O3 — CID 113054791
tert-butyl N-[2-[acetyl-[(2-chlorophenyl)methyl]amino]ethyl]carbamate (PubChem CID 113054791) has the molecular formula C16H23ClN2O3 and a molecular weight of 326.82 g/mol. Its IUPAC name is tert-butyl N-[2-[acetyl-[(2-chlorophenyl)methyl]amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[acetyl-[(2-chlorophenyl)methyl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 113054791 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | tert-butyl N-[2-[acetyl-[(2-chlorophenyl)methyl]amino]ethyl]carbamate |
| SMILES | CC(=O)N(CCNC(=O)OC(C)(C)C)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClN2O3/c1-12(20)19(11-13-7-5-6-8-14(13)17)10-9-18-15(21)22-16(2,3)4/h5-8H,9-11H2,1-4H3,(H,18,21) |
| InChIKey | LEYNEIWMCCILJC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |