C15H23N3O3 — CID 113055221
tert-butyl N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]carbamate (PubChem CID 113055221) has the molecular formula C15H23N3O3 and a molecular weight of 293.37 g/mol. Its IUPAC name is tert-butyl N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 113055221 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | tert-butyl N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]carbamate |
| SMILES | CC(=O)N(CCNC(=O)OC(C)(C)C)Cc1ccccn1 |
| InChI | InChI=1S/C15H23N3O3/c1-12(19)18(11-13-7-5-6-8-16-13)10-9-17-14(20)21-15(2,3)4/h5-8H,9-11H2,1-4H3,(H,17,20) |
| InChIKey | CJPWMTUYFJBCGU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |