C16H19N3O2S — CID 113055189
N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-2-thiophen-2-ylacetamide (PubChem CID 113055189) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113055189 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-2-thiophen-2-ylacetamide |
| SMILES | CC(=O)N(CCNC(=O)Cc1cccs1)Cc1ccccn1 |
| InChI | InChI=1S/C16H19N3O2S/c1-13(20)19(12-14-5-2-3-7-17-14)9-8-18-16(21)11-15-6-4-10-22-15/h2-7,10H,8-9,11-12H2,1H3,(H,18,21) |
| InChIKey | CVBNMAXHYPPYQK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |