C17H18FN3O2 — CID 113055172
N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-3-fluorobenzamide (PubChem CID 113055172) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-3-fluorobenzamide.
| Compound Name | N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 113055172 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | N-[2-[acetyl(pyridin-2-ylmethyl)amino]ethyl]-3-fluorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1cccc(F)c1)Cc1ccccn1 |
| InChI | InChI=1S/C17H18FN3O2/c1-13(22)21(12-16-7-2-3-8-19-16)10-9-20-17(23)14-5-4-6-15(18)11-14/h2-8,11H,9-10,12H2,1H3,(H,20,23) |
| InChIKey | NNGQVZXXBMAQDE-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |