C14H21NO5S — CID 175577390
[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] methanesulfonate (PubChem CID 175577390) has the molecular formula C14H21NO5S and a molecular weight of 315.39 g/mol. Its IUPAC name is [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] methanesulfonate.
| Compound Name | [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 175577390 |
| Molecular Formula | C14H21NO5S |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | [2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]phenyl] methanesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCc1ccccc1OS(C)(=O)=O |
| InChI | InChI=1S/C14H21NO5S/c1-14(2,3)19-13(16)15-10-9-11-7-5-6-8-12(11)20-21(4,17)18/h5-8H,9-10H2,1-4H3,(H,15,16) |
| InChIKey | WYIXUJIBBCJZNI-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|