C16H23NO7S — CID 87298004
[2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-methylsulfonyloxyphenyl)ethyl] acetate (PubChem CID 87298004) has the molecular formula C16H23NO7S and a molecular weight of 373.43 g/mol. Its IUPAC name is [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-methylsulfonyloxyphenyl)ethyl] acetate.
| Compound Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-methylsulfonyloxyphenyl)ethyl] acetate |
|---|---|
| PubChem CID | 87298004 |
| Molecular Formula | C16H23NO7S |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | [2-[(2-methylpropan-2-yl)oxycarbonylamino]-1-(2-methylsulfonyloxyphenyl)ethyl] acetate |
| SMILES | CC(=O)OC(CNC(=O)OC(C)(C)C)c1ccccc1OS(C)(=O)=O |
| InChI | InChI=1S/C16H23NO7S/c1-11(18)22-14(10-17-15(19)23-16(2,3)4)12-8-6-7-9-13(12)24-25(5,20)21/h6-9,14H,10H2,1-5H3,(H,17,19) |
| InChIKey | MZBXSASERAFPFE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|