C19H29NO7S — CID 87296361
tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-methylsulfonyloxyphenyl)propanoate (PubChem CID 87296361) has the molecular formula C19H29NO7S and a molecular weight of 415.51 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-methylsulfonyloxyphenyl)propanoate.
| Compound Name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-methylsulfonyloxyphenyl)propanoate |
|---|---|
| PubChem CID | 87296361 |
| Molecular Formula | C19H29NO7S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(3-methylsulfonyloxyphenyl)propanoate |
| SMILES | CC(C)(C)OC(=O)NCC(C(=O)OC(C)(C)C)c1cccc(OS(C)(=O)=O)c1 |
| InChI | InChI=1S/C19H29NO7S/c1-18(2,3)25-16(21)15(12-20-17(22)26-19(4,5)6)13-9-8-10-14(11-13)27-28(7,23)24/h8-11,15H,12H2,1-7H3,(H,20,22) |
| InChIKey | QHRFXIKRNHIHFM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|