C13H19IN2O2 — CID 99909259
tert-butyl N-[(2S)-2-amino-2-(3-iodophenyl)ethyl]carbamate (PubChem CID 99909259) has the molecular formula C13H19IN2O2 and a molecular weight of 362.21 g/mol. Its IUPAC name is tert-butyl N-[(2S)-2-amino-2-(3-iodophenyl)ethyl]carbamate.
| Compound Name | tert-butyl N-[(2S)-2-amino-2-(3-iodophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 99909259 |
| Molecular Formula | C13H19IN2O2 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | tert-butyl N-[(2S)-2-amino-2-(3-iodophenyl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H](N)c1cccc(I)c1 |
| InChI | InChI=1S/C13H19IN2O2/c1-13(2,3)18-12(17)16-8-11(15)9-5-4-6-10(14)7-9/h4-7,11H,8,15H2,1-3H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | HOUZNXNTDGYGON-LLVKDONJSA-N |
| XLogP | 2.82 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|