C16H24IN3O5 — CID 174596553
3-iodoaniline;methyl 2-formamido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 174596553) has the molecular formula C16H24IN3O5 and a molecular weight of 465.29 g/mol. Its IUPAC name is 3-iodoaniline;methyl 2-formamido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | 3-iodoaniline;methyl 2-formamido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 174596553 |
| Molecular Formula | C16H24IN3O5 |
| Molecular Weight | 465.29 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 3-iodoaniline;methyl 2-formamido-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)C(CNC(=O)OC(C)(C)C)NC=O.Nc1cccc(I)c1 |
| InChI | InChI=1S/C10H18N2O5.C6H6IN/c1-10(2,3)17-9(15)11-5-7(12-6-13)8(14)16-4;7-5-2-1-3-6(8)4-5/h6-7H,5H2,1-4H3,(H,11,15)(H,12,13);1-4H,8H2 |
| InChIKey | LWXWBAIZFFPCRC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 119.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|