C16H24N2O6 — CID 170832798
methyl 5-amino-2-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoate (PubChem CID 170832798) has the molecular formula C16H24N2O6 and a molecular weight of 340.38 g/mol. Its IUPAC name is methyl 5-amino-2-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoate.
| Compound Name | methyl 5-amino-2-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoate |
|---|---|
| PubChem CID | 170832798 |
| Molecular Formula | C16H24N2O6 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | methyl 5-amino-2-[1,2-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]propyl]benzoate |
| SMILES | COC(=O)c1cc(N)ccc1C(O)C(O)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O6/c1-16(2,3)24-15(22)18-8-12(19)13(20)10-6-5-9(17)7-11(10)14(21)23-4/h5-7,12-13,19-20H,8,17H2,1-4H3,(H,18,22) |
| InChIKey | FKCOIUAXPZXEES-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|