C14H19NO5S — CID 171876567
methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-5-aminobenzoate (PubChem CID 171876567) has the molecular formula C14H19NO5S and a molecular weight of 313.38 g/mol. Its IUPAC name is methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-5-aminobenzoate.
| Compound Name | methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-5-aminobenzoate |
|---|---|
| PubChem CID | 171876567 |
| Molecular Formula | C14H19NO5S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | methyl 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-5-aminobenzoate |
| SMILES | COC(=O)c1cc(N)ccc1C(O)C(O)CCSC(C)=O |
| InChI | InChI=1S/C14H19NO5S/c1-8(16)21-6-5-12(17)13(18)10-4-3-9(15)7-11(10)14(19)20-2/h3-4,7,12-13,17-18H,5-6,15H2,1-2H3 |
| InChIKey | KXTUKDFQFFKPQY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|