C15H20O5S — CID 171876456
methyl 2-[2-(4-acetylsulfanyl-1,2-dihydroxybutyl)phenyl]acetate (PubChem CID 171876456) has the molecular formula C15H20O5S and a molecular weight of 312.39 g/mol. Its IUPAC name is methyl 2-[2-(4-acetylsulfanyl-1,2-dihydroxybutyl)phenyl]acetate.
| Compound Name | methyl 2-[2-(4-acetylsulfanyl-1,2-dihydroxybutyl)phenyl]acetate |
|---|---|
| PubChem CID | 171876456 |
| Molecular Formula | C15H20O5S |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | methyl 2-[2-(4-acetylsulfanyl-1,2-dihydroxybutyl)phenyl]acetate |
| SMILES | COC(=O)Cc1ccccc1C(O)C(O)CCSC(C)=O |
| InChI | InChI=1S/C15H20O5S/c1-10(16)21-8-7-13(17)15(19)12-6-4-3-5-11(12)9-14(18)20-2/h3-6,13,15,17,19H,7-9H2,1-2H3 |
| InChIKey | AMNBXPONGFEDOJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|