C13H15F3O5S — CID 171876737
S-[3,4-dihydroxy-4-[5-hydroxy-2-(trifluoromethoxy)phenyl]butyl] ethanethioate (PubChem CID 171876737) has the molecular formula C13H15F3O5S and a molecular weight of 340.32 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-[5-hydroxy-2-(trifluoromethoxy)phenyl]butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-[5-hydroxy-2-(trifluoromethoxy)phenyl]butyl] ethanethioate |
|---|---|
| PubChem CID | 171876737 |
| Molecular Formula | C13H15F3O5S |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | S-[3,4-dihydroxy-4-[5-hydroxy-2-(trifluoromethoxy)phenyl]butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(O)ccc1OC(F)(F)F |
| InChI | InChI=1S/C13H15F3O5S/c1-7(17)22-5-4-10(19)12(20)9-6-8(18)2-3-11(9)21-13(14,15)16/h2-3,6,10,12,18-20H,4-5H2,1H3 |
| InChIKey | HMSPMIVOFUQKJO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|