C13H17FO3S — CID 171875420
S-[4-(2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171875420) has the molecular formula C13H17FO3S and a molecular weight of 272.34 g/mol. Its IUPAC name is S-[4-(2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171875420 |
| Molecular Formula | C13H17FO3S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | S-[4-(2-fluoro-5-methylphenyl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1cc(C)ccc1F |
| InChI | InChI=1S/C13H17FO3S/c1-8-3-4-11(14)10(7-8)13(17)12(16)5-6-18-9(2)15/h3-4,7,12-13,16-17H,5-6H2,1-2H3 |
| InChIKey | VFMLYMMGKBPGTO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|