C13H15FO5S — CID 171876160
2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-6-fluorobenzoic acid (PubChem CID 171876160) has the molecular formula C13H15FO5S and a molecular weight of 302.32 g/mol. Its IUPAC name is 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-6-fluorobenzoic acid.
| Compound Name | 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 171876160 |
| Molecular Formula | C13H15FO5S |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 2-(4-acetylsulfanyl-1,2-dihydroxybutyl)-6-fluorobenzoic acid |
| SMILES | CC(=O)SCCC(O)C(O)c1cccc(F)c1C(=O)O |
| InChI | InChI=1S/C13H15FO5S/c1-7(15)20-6-5-10(16)12(17)8-3-2-4-9(14)11(8)13(18)19/h2-4,10,12,16-17H,5-6H2,1H3,(H,18,19) |
| InChIKey | UQTFUGBOUIIJAX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|