C10H10BrFO4 — CID 171860258
2-(3-bromo-1,2-dihydroxypropyl)-6-fluorobenzoic acid (PubChem CID 171860258) has the molecular formula C10H10BrFO4 and a molecular weight of 293.09 g/mol. Its IUPAC name is 2-(3-bromo-1,2-dihydroxypropyl)-6-fluorobenzoic acid.
| Compound Name | 2-(3-bromo-1,2-dihydroxypropyl)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 171860258 |
| Molecular Formula | C10H10BrFO4 |
| Molecular Weight | 293.09 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2-(3-bromo-1,2-dihydroxypropyl)-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)cccc1C(O)C(O)CBr |
| InChI | InChI=1S/C10H10BrFO4/c11-4-7(13)9(14)5-2-1-3-6(12)8(5)10(15)16/h1-3,7,9,13-14H,4H2,(H,15,16) |
| InChIKey | CIAMALWHFHXLSU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.09 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|