C10H9FO6 — CID 170824233
2-(2-carboxy-1,2-dihydroxyethyl)-6-fluorobenzoic acid (PubChem CID 170824233) has the molecular formula C10H9FO6 and a molecular weight of 244.17 g/mol. Its IUPAC name is 2-(2-carboxy-1,2-dihydroxyethyl)-6-fluorobenzoic acid.
| Compound Name | 2-(2-carboxy-1,2-dihydroxyethyl)-6-fluorobenzoic acid |
|---|---|
| PubChem CID | 170824233 |
| Molecular Formula | C10H9FO6 |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-(2-carboxy-1,2-dihydroxyethyl)-6-fluorobenzoic acid |
| SMILES | O=C(O)c1c(F)cccc1C(O)C(O)C(=O)O |
| InChI | InChI=1S/C10H9FO6/c11-5-3-1-2-4(6(5)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17) |
| InChIKey | DBUHSRCGNAPEDC-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |