3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid

C9H8ClFO4 — CID 170823544

IUPAC3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid
SMILESO=C(O)C(O)C(O)c1c(F)cccc1Cl
InChIInChI=1S/C9H8ClFO4/c10-4-2-1-3-5(11)6(4)7(12)8(13)9(14)15/h1-3,7-8,12-13H,(H,14,15)
InChIKeyZRALBEDOHSSNNW-UHFFFAOYSA-N
MW234.61 g/mol
LogP0.96
Rot. Bonds3

About 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid

3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170823544) has the molecular formula C9H8ClFO4 and a molecular weight of 234.61 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid.

Molecular Properties

Compound Name3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid
PubChem CID170823544
Molecular FormulaC9H8ClFO4
Molecular Weight234.61 g/mol
Exact Mass234.01
IUPAC Name3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid
SMILESO=C(O)C(O)C(O)c1c(F)cccc1Cl
InChIInChI=1S/C9H8ClFO4/c10-4-2-1-3-5(11)6(4)7(12)8(13)9(14)15/h1-3,7-8,12-13H,(H,14,15)
InChIKeyZRALBEDOHSSNNW-UHFFFAOYSA-N
XLogP0.96
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.61
LogP ≤ 50.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid?
The IUPAC name of 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid (CID 170823544) is 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid.
What is the SMILES notation for 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid?
The canonical SMILES for 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid is O=C(O)C(O)C(O)c1c(F)cccc1Cl.
What is the InChIKey of 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid?
The InChIKey is ZRALBEDOHSSNNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClFO4/c10-4-2-1-3-5(11)6(4)7(12)8(13)9(14)15/h1-3,7-8,12-13H,(H,14,15).
What are the key properties of 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid?
3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid has a molecular weight of 234.61 g/mol, XLogP of 0.96, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid is sourced from PubChem (CID 170823544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).