C9H8ClFO4 — CID 170823544
3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid (PubChem CID 170823544) has the molecular formula C9H8ClFO4 and a molecular weight of 234.61 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid |
|---|---|
| PubChem CID | 170823544 |
| Molecular Formula | C9H8ClFO4 |
| Molecular Weight | 234.61 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-2,3-dihydroxypropanoic acid |
| SMILES | O=C(O)C(O)C(O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C9H8ClFO4/c10-4-2-1-3-5(11)6(4)7(12)8(13)9(14)15/h1-3,7-8,12-13H,(H,14,15) |
| InChIKey | ZRALBEDOHSSNNW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.61 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |