C9H8ClFO3 — CID 94425333
(3S)-3-(2-chloro-6-fluorophenyl)-3-hydroxypropanoic acid (PubChem CID 94425333) has the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. Its IUPAC name is (3S)-3-(2-chloro-6-fluorophenyl)-3-hydroxypropanoic acid.
| Compound Name | (3S)-3-(2-chloro-6-fluorophenyl)-3-hydroxypropanoic acid |
|---|---|
| PubChem CID | 94425333 |
| Molecular Formula | C9H8ClFO3 |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | (3S)-3-(2-chloro-6-fluorophenyl)-3-hydroxypropanoic acid |
| SMILES | O=C(O)C[C@H](O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C9H8ClFO3/c10-5-2-1-3-6(11)9(5)7(12)4-8(13)14/h1-3,7,12H,4H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | WCJJEFMZULWAJP-ZETCQYMHSA-N |
| XLogP | 1.99 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |