C9H12ClFN2O3S — CID 72703552
1-chloro-3-fluoro-2-[1-hydroxy-3-(sulfamoylamino)propyl]benzene (PubChem CID 72703552) has the molecular formula C9H12ClFN2O3S and a molecular weight of 282.72 g/mol. Its IUPAC name is 1-chloro-3-fluoro-2-[1-hydroxy-3-(sulfamoylamino)propyl]benzene.
| Compound Name | 1-chloro-3-fluoro-2-[1-hydroxy-3-(sulfamoylamino)propyl]benzene |
|---|---|
| PubChem CID | 72703552 |
| Molecular Formula | C9H12ClFN2O3S |
| Molecular Weight | 282.72 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 1-chloro-3-fluoro-2-[1-hydroxy-3-(sulfamoylamino)propyl]benzene |
| SMILES | NS(=O)(=O)NCCC(O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C9H12ClFN2O3S/c10-6-2-1-3-7(11)9(6)8(14)4-5-13-17(12,15)16/h1-3,8,13-14H,4-5H2,(H2,12,15,16) |
| InChIKey | ALNZYTWSJJHGKA-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.72 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |