C8H9F3N2O2S — CID 57344561
1,3-difluoro-2-[1-fluoro-2-(sulfamoylamino)ethyl]benzene (PubChem CID 57344561) has the molecular formula C8H9F3N2O2S and a molecular weight of 254.23 g/mol. Its IUPAC name is 1,3-difluoro-2-[1-fluoro-2-(sulfamoylamino)ethyl]benzene.
| Compound Name | 1,3-difluoro-2-[1-fluoro-2-(sulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 57344561 |
| Molecular Formula | C8H9F3N2O2S |
| Molecular Weight | 254.23 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1,3-difluoro-2-[1-fluoro-2-(sulfamoylamino)ethyl]benzene |
| SMILES | NS(=O)(=O)NCC(F)c1c(F)cccc1F |
| InChI | InChI=1S/C8H9F3N2O2S/c9-5-2-1-3-6(10)8(5)7(11)4-13-16(12,14)15/h1-3,7,13H,4H2,(H2,12,14,15) |
| InChIKey | NTIVJQWQQOGOSL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |