C8H10F2N2O3S — CID 111450119
1,3-difluoro-2-[1-hydroxy-2-(sulfamoylamino)ethyl]benzene (PubChem CID 111450119) has the molecular formula C8H10F2N2O3S and a molecular weight of 252.24 g/mol. Its IUPAC name is 1,3-difluoro-2-[1-hydroxy-2-(sulfamoylamino)ethyl]benzene.
| Compound Name | 1,3-difluoro-2-[1-hydroxy-2-(sulfamoylamino)ethyl]benzene |
|---|---|
| PubChem CID | 111450119 |
| Molecular Formula | C8H10F2N2O3S |
| Molecular Weight | 252.24 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 1,3-difluoro-2-[1-hydroxy-2-(sulfamoylamino)ethyl]benzene |
| SMILES | NS(=O)(=O)NCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C8H10F2N2O3S/c9-5-2-1-3-6(10)8(5)7(13)4-12-16(11,14)15/h1-3,7,12-13H,4H2,(H2,11,14,15) |
| InChIKey | FHNULIUGVOYHDC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |