C13H19F2NO2 — CID 106131236
5-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]pentan-2-ol (PubChem CID 106131236) has the molecular formula C13H19F2NO2 and a molecular weight of 259.30 g/mol. Its IUPAC name is 5-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]pentan-2-ol.
| Compound Name | 5-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]pentan-2-ol |
|---|---|
| PubChem CID | 106131236 |
| Molecular Formula | C13H19F2NO2 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 5-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]pentan-2-ol |
| SMILES | CC(O)CCCNCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H19F2NO2/c1-9(17)4-3-7-16-8-12(18)13-10(14)5-2-6-11(13)15/h2,5-6,9,12,16-18H,3-4,7-8H2,1H3 |
| InChIKey | JHCHCQXGHLBKPU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|