C14H19F2NO3 — CID 64578937
ethyl 4-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]butanoate (PubChem CID 64578937) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is ethyl 4-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]butanoate.
| Compound Name | ethyl 4-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]butanoate |
|---|---|
| PubChem CID | 64578937 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 4-[[2-(2,6-difluorophenyl)-2-hydroxyethyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO3/c1-2-20-13(19)7-4-8-17-9-12(18)14-10(15)5-3-6-11(14)16/h3,5-6,12,17-18H,2,4,7-9H2,1H3 |
| InChIKey | ZXVKINMZWQOEMF-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|