C13H15FO5 — CID 118847911
2-[2-(3-ethoxy-3-oxopropyl)-6-fluorophenyl]-2-hydroxyacetic acid (PubChem CID 118847911) has the molecular formula C13H15FO5 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-[2-(3-ethoxy-3-oxopropyl)-6-fluorophenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-ethoxy-3-oxopropyl)-6-fluorophenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118847911 |
| Molecular Formula | C13H15FO5 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-[2-(3-ethoxy-3-oxopropyl)-6-fluorophenyl]-2-hydroxyacetic acid |
| SMILES | CCOC(=O)CCc1cccc(F)c1C(O)C(=O)O |
| InChI | InChI=1S/C13H15FO5/c1-2-19-10(15)7-6-8-4-3-5-9(14)11(8)12(16)13(17)18/h3-5,12,16H,2,6-7H2,1H3,(H,17,18) |
| InChIKey | WURICOZBFPKQJN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |