C14H16O6 — CID 118814100
2-[2-(3-ethoxy-3-oxopropyl)-4-formylphenyl]-2-hydroxyacetic acid (PubChem CID 118814100) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-[2-(3-ethoxy-3-oxopropyl)-4-formylphenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[2-(3-ethoxy-3-oxopropyl)-4-formylphenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118814100 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-[2-(3-ethoxy-3-oxopropyl)-4-formylphenyl]-2-hydroxyacetic acid |
| SMILES | CCOC(=O)CCc1cc(C=O)ccc1C(O)C(=O)O |
| InChI | InChI=1S/C14H16O6/c1-2-20-12(16)6-4-10-7-9(8-15)3-5-11(10)13(17)14(18)19/h3,5,7-8,13,17H,2,4,6H2,1H3,(H,18,19) |
| InChIKey | ZPVKQXAWMRDCEE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|