C14H17ClO5 — CID 118801741
2-[4-(chloromethyl)-2-(3-ethoxy-3-oxopropyl)phenyl]-2-hydroxyacetic acid (PubChem CID 118801741) has the molecular formula C14H17ClO5 and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-[4-(chloromethyl)-2-(3-ethoxy-3-oxopropyl)phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-(chloromethyl)-2-(3-ethoxy-3-oxopropyl)phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118801741 |
| Molecular Formula | C14H17ClO5 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-[4-(chloromethyl)-2-(3-ethoxy-3-oxopropyl)phenyl]-2-hydroxyacetic acid |
| SMILES | CCOC(=O)CCc1cc(CCl)ccc1C(O)C(=O)O |
| InChI | InChI=1S/C14H17ClO5/c1-2-20-12(16)6-4-10-7-9(8-15)3-5-11(10)13(17)14(18)19/h3,5,7,13,17H,2,4,6,8H2,1H3,(H,18,19) |
| InChIKey | UIQLWUPGXSGNQF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|