C12H14BrClO2 — CID 131612411
ethyl 3-[4-bromo-3-(chloromethyl)phenyl]propanoate (PubChem CID 131612411) has the molecular formula C12H14BrClO2 and a molecular weight of 305.60 g/mol. Its IUPAC name is ethyl 3-[4-bromo-3-(chloromethyl)phenyl]propanoate.
| Compound Name | ethyl 3-[4-bromo-3-(chloromethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 131612411 |
| Molecular Formula | C12H14BrClO2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 303.99 |
| IUPAC Name | ethyl 3-[4-bromo-3-(chloromethyl)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(Br)c(CCl)c1 |
| InChI | InChI=1S/C12H14BrClO2/c1-2-16-12(15)6-4-9-3-5-11(13)10(7-9)8-14/h3,5,7H,2,4,6,8H2,1H3 |
| InChIKey | PXAUBYBDUUEQHB-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|