C14H15F3O5 — CID 171898254
ethyl 4-[4-formyl-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoate (PubChem CID 171898254) has the molecular formula C14H15F3O5 and a molecular weight of 320.26 g/mol. Its IUPAC name is ethyl 4-[4-formyl-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-[4-formyl-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171898254 |
| Molecular Formula | C14H15F3O5 |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | ethyl 4-[4-formyl-2-(trifluoromethyl)phenyl]-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1ccc(C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3O5/c1-2-22-12(20)6-11(19)13(21)9-4-3-8(7-18)5-10(9)14(15,16)17/h3-5,7,11,13,19,21H,2,6H2,1H3 |
| InChIKey | JTBPXTCNVLAGHT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|