C12H12F3N3O3 — CID 171880337
4-(4-azido-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzaldehyde (PubChem CID 171880337) has the molecular formula C12H12F3N3O3 and a molecular weight of 303.24 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzaldehyde.
| Compound Name | 4-(4-azido-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzaldehyde |
|---|---|
| PubChem CID | 171880337 |
| Molecular Formula | C12H12F3N3O3 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 4-(4-azido-1,2-dihydroxybutyl)-3-(trifluoromethyl)benzaldehyde |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C12H12F3N3O3/c13-12(14,15)9-5-7(6-19)1-2-8(9)11(21)10(20)3-4-17-18-16/h1-2,5-6,10-11,20-21H,3-4H2 |
| InChIKey | ZMQCJIQWAJZZIT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|