C11H13F3N4O2 — CID 171880116
1-[2-amino-5-(trifluoromethyl)phenyl]-4-azidobutane-1,2-diol (PubChem CID 171880116) has the molecular formula C11H13F3N4O2 and a molecular weight of 290.25 g/mol. Its IUPAC name is 1-[2-amino-5-(trifluoromethyl)phenyl]-4-azidobutane-1,2-diol.
| Compound Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-4-azidobutane-1,2-diol |
|---|---|
| PubChem CID | 171880116 |
| Molecular Formula | C11H13F3N4O2 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[2-amino-5-(trifluoromethyl)phenyl]-4-azidobutane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1cc(C(F)(F)F)ccc1N |
| InChI | InChI=1S/C11H13F3N4O2/c12-11(13,14)6-1-2-8(15)7(5-6)10(20)9(19)3-4-17-18-16/h1-2,5,9-10,19-20H,3-4,15H2 |
| InChIKey | HKTBIFYYZOXURS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|