C10H12Cl2N4O2 — CID 171879542
1-(4-amino-2,6-dichlorophenyl)-4-azidobutane-1,2-diol (PubChem CID 171879542) has the molecular formula C10H12Cl2N4O2 and a molecular weight of 291.14 g/mol. Its IUPAC name is 1-(4-amino-2,6-dichlorophenyl)-4-azidobutane-1,2-diol.
| Compound Name | 1-(4-amino-2,6-dichlorophenyl)-4-azidobutane-1,2-diol |
|---|---|
| PubChem CID | 171879542 |
| Molecular Formula | C10H12Cl2N4O2 |
| Molecular Weight | 291.14 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 1-(4-amino-2,6-dichlorophenyl)-4-azidobutane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N4O2/c11-6-3-5(13)4-7(12)9(6)10(18)8(17)1-2-15-16-14/h3-4,8,10,17-18H,1-2,13H2 |
| InChIKey | YGTGTYKZCVXKGZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 115.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|