C9H12ClN5O2 — CID 171880559
1-(4-amino-2-chloro-3-pyridinyl)-4-azidobutane-1,2-diol (PubChem CID 171880559) has the molecular formula C9H12ClN5O2 and a molecular weight of 257.68 g/mol. Its IUPAC name is 1-(4-amino-2-chloro-3-pyridinyl)-4-azidobutane-1,2-diol.
| Compound Name | 1-(4-amino-2-chloro-3-pyridinyl)-4-azidobutane-1,2-diol |
|---|---|
| PubChem CID | 171880559 |
| Molecular Formula | C9H12ClN5O2 |
| Molecular Weight | 257.68 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-(4-amino-2-chloro-3-pyridinyl)-4-azidobutane-1,2-diol |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1c(N)ccnc1Cl |
| InChI | InChI=1S/C9H12ClN5O2/c10-9-7(5(11)1-3-13-9)8(17)6(16)2-4-14-15-12/h1,3,6,8,16-17H,2,4H2,(H2,11,13) |
| InChIKey | XNVKDLHMWSBEQS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 128.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.68 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|