C10H14ClNO3 — CID 171872018
1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2,4-triol (PubChem CID 171872018) has the molecular formula C10H14ClNO3 and a molecular weight of 231.68 g/mol. Its IUPAC name is 1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872018 |
| Molecular Formula | C10H14ClNO3 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | 1-(2-chloro-4-methyl-3-pyridinyl)butane-1,2,4-triol |
| SMILES | Cc1ccnc(Cl)c1C(O)C(O)CCO |
| InChI | InChI=1S/C10H14ClNO3/c1-6-2-4-12-10(11)8(6)9(15)7(14)3-5-13/h2,4,7,9,13-15H,3,5H2,1H3 |
| InChIKey | PESWHZPEHFPAEI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|