C12H18O3 — CID 171871856
1-(2,5-dimethylphenyl)butane-1,2,4-triol (PubChem CID 171871856) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)butane-1,2,4-triol.
| Compound Name | 1-(2,5-dimethylphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871856 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(2,5-dimethylphenyl)butane-1,2,4-triol |
| SMILES | Cc1ccc(C)c(C(O)C(O)CCO)c1 |
| InChI | InChI=1S/C12H18O3/c1-8-3-4-9(2)10(7-8)12(15)11(14)5-6-13/h3-4,7,11-15H,5-6H2,1-2H3 |
| InChIKey | PZPCMQWVHJEUPB-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |