C10H14FNO3 — CID 171873399
1-(2-fluoro-5-methyl-4-pyridinyl)butane-1,2,4-triol (PubChem CID 171873399) has the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. Its IUPAC name is 1-(2-fluoro-5-methyl-4-pyridinyl)butane-1,2,4-triol.
| Compound Name | 1-(2-fluoro-5-methyl-4-pyridinyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171873399 |
| Molecular Formula | C10H14FNO3 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1-(2-fluoro-5-methyl-4-pyridinyl)butane-1,2,4-triol |
| SMILES | Cc1cnc(F)cc1C(O)C(O)CCO |
| InChI | InChI=1S/C10H14FNO3/c1-6-5-12-9(11)4-7(6)10(15)8(14)2-3-13/h4-5,8,10,13-15H,2-3H2,1H3 |
| InChIKey | IGXNMXKLHWAXTN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|