C11H15FO3 — CID 171871828
1-(5-fluoro-2-methylphenyl)butane-1,2,4-triol (PubChem CID 171871828) has the molecular formula C11H15FO3 and a molecular weight of 214.24 g/mol. Its IUPAC name is 1-(5-fluoro-2-methylphenyl)butane-1,2,4-triol.
| Compound Name | 1-(5-fluoro-2-methylphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171871828 |
| Molecular Formula | C11H15FO3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1-(5-fluoro-2-methylphenyl)butane-1,2,4-triol |
| SMILES | Cc1ccc(F)cc1C(O)C(O)CCO |
| InChI | InChI=1S/C11H15FO3/c1-7-2-3-8(12)6-9(7)11(15)10(14)4-5-13/h2-3,6,10-11,13-15H,4-5H2,1H3 |
| InChIKey | FBOVPDGDCTXMOL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |