C13H17FO4 — CID 171896910
ethyl 4-(5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171896910) has the molecular formula C13H17FO4 and a molecular weight of 256.27 g/mol. Its IUPAC name is ethyl 4-(5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896910 |
| Molecular Formula | C13H17FO4 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | ethyl 4-(5-fluoro-2-methylphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cc(F)ccc1C |
| InChI | InChI=1S/C13H17FO4/c1-3-18-12(16)7-11(15)13(17)10-6-9(14)5-4-8(10)2/h4-6,11,13,15,17H,3,7H2,1-2H3 |
| InChIKey | RGIKSRRJEKGNBT-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |