C14H19FO4 — CID 171897215
ethyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate (PubChem CID 171897215) has the molecular formula C14H19FO4 and a molecular weight of 270.30 g/mol. Its IUPAC name is ethyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171897215 |
| Molecular Formula | C14H19FO4 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | ethyl 4-(4-fluoro-2,6-dimethylphenyl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C14H19FO4/c1-4-19-12(17)7-11(16)14(18)13-8(2)5-10(15)6-9(13)3/h5-6,11,14,16,18H,4,7H2,1-3H3 |
| InChIKey | SOQMITZADKQEEF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |