C10H13FN2O4 — CID 171896822
ethyl 4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutanoate (PubChem CID 171896822) has the molecular formula C10H13FN2O4 and a molecular weight of 244.22 g/mol. Its IUPAC name is ethyl 4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutanoate.
| Compound Name | ethyl 4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutanoate |
|---|---|
| PubChem CID | 171896822 |
| Molecular Formula | C10H13FN2O4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | ethyl 4-(2-fluoropyrimidin-5-yl)-3,4-dihydroxybutanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cnc(F)nc1 |
| InChI | InChI=1S/C10H13FN2O4/c1-2-17-8(15)3-7(14)9(16)6-4-12-10(11)13-5-6/h4-5,7,9,14,16H,2-3H2,1H3 |
| InChIKey | KRFYYKHAGXBYMH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 92.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |