C12H17NO4 — CID 171896867
ethyl 3,4-dihydroxy-4-(5-methyl-3-pyridinyl)butanoate (PubChem CID 171896867) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(5-methyl-3-pyridinyl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(5-methyl-3-pyridinyl)butanoate |
|---|---|
| PubChem CID | 171896867 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(5-methyl-3-pyridinyl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1cncc(C)c1 |
| InChI | InChI=1S/C12H17NO4/c1-3-17-11(15)5-10(14)12(16)9-4-8(2)6-13-7-9/h4,6-7,10,12,14,16H,3,5H2,1-2H3 |
| InChIKey | WHJPRLYWMCJLTE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 79.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |